CAS:41731-23-1 | 2-Bromo-5-methylthiazole
Molecular Formula:C4H4BrNS
Molecular Weight:178.05g/mol
Purity:96%
Package:5g/10g/25g/50g/bulk package
Transportation:FeDex/DHL/Ocean shipping/Clients requirement
- משלוחים לכל העולם
- בקרת איכות
- שירות לקוחות 24/7
הצגת המוצר
Applications
2-Bromo-5-methylthiazole(CAS:41731-23-1) is used in a variety of scientific research applications, including its use as an inhibitor of enzymes, a catalyst for organic reactions, and a reactant in chemical synthesis. It is also used in the synthesis of other compounds, such as thiazolines, thiophenes, and thiolactones. Additionally, 2-Br-5-MeT is used in the synthesis of pharmaceuticals, fragrances, and dyes.
Specification
|
ITEMS |
SPECIFICATION |
|
IUPAC Name |
2-bromo-5-methyl-1,3-thiazole |
|
MDL No |
MFCD06660130 |
|
Boiling Point |
192-200°C |
|
Melting Point |
31.67° C (Predicted) |
|
Flash Point |
71.8±18.7 °C |
|
Density |
1.7 g/cm3 (Predicted) |
|
PSA |
41.13 |
|
LogP |
2.39 |
|
Appearance |
Colorless to light yellow (Liquid) |
|
Vapour Pressure |
0.6±0.4 mmHg at 25°C |
|
Refractive index |
1.589 |
|
Storage condition |
Store at room temperature |
|
InChI |
InChI=1S/C4H4BrNS/c1-3-2-6-4(5)7-3/h2H,1H3 |
|
InChIKey |
FJPZHYAYNAUKKA-UHFFFAOYSA-N |

תגיות פופולריות: cas:41731-23-1 | 2-bromo-5-methylthiazole, price, quotation, discount, in stock, for sale







![CAS:119851-28-4|1-[2-כלורו-4-(4-כלורופנוקסי)פניל]אתאן-1-אחד](/uploads/202235855/small/cas-119851-28-4-1-2-chloro-4-4-chlorophenoxy27938fe6-b4f2-4cd2-8860-67ab69f0d884.jpg?size=384x0)
