CAS:202865-77-8|2-Bromo-4-fluoro-6-methylaniline
Molecular Formula:C7H7BrFN
Molecular Weight:204.04 g/mol
Purity:98 percent
Package:500g/1kg/5kg/10kg/bulk package
- משלוחים לכל העולם
- בקרת איכות
- שירות לקוחות 24/7
הצגת המוצר
2-Bromo-4-fluoro-6-methylaniline has been used in a variety of scientific research applications. It has been used as a starting material for the synthesis of bioactive compounds, such as antibiotics and anti-cancer drugs. It has also been used in the synthesis of other organic compounds, such as dyes and pigments. Additionally, 2-Bromo-4-fluoro-6-methylaniline has been used in the synthesis of polymers and other materials.
|
|
|
| 2-bromo-4-fluoro-6-methylaniline | |
| MFCD01861196 | |
| 1.589g/cm3 | |
| 248.9ºC at 760 mmHg | |
| 32-36ºC | |
| 110ºC | |
| InChI=1S/C7H7BrFN/c1-4-2-5(9)3-6(8)7(4)10/h2-3H,10H2,1H3 | |
| VTWSBILIFIFEFG-UHFFFAOYSA-N |
תגיות פופולריות: cas:202865-77-8|2-bromo-4-fluoro-6-methylaniline, price, quotation, discount, in stock, for sale
