CAS:113882-33-0|3-Methyl-5-nitrobenzoic Acid
Molecular Formula:C8H7NO4
Molecular Weight:181.15g/mol
Purity:98 percent
Package:100g/250g/500g/1kg/bulk package
- משלוחים לכל העולם
- בקרת איכות
- שירות לקוחות 24/7
הצגת המוצר
3-Methyl-5-nitrobenzoic acid has a variety of applications in scientific research. It is used as a reagent for the synthesis of organic compounds, and has been used in the synthesis of heterocyclic compounds and pharmaceuticals. 3-Methyl-5-nitrobenzoic acid is also used in the synthesis of dyes, and as a catalyst in organic reactions. Additionally, 3-Methyl-5-nitrobenzoic acid is used as a fluorescent probe in biological assays.
|
|
|
| 3-methyl-5-nitrobenzoic acid | |
| MFCD00129754 | |
| 83.12 | |
| 2.12 | |
| InChI=1S/C8H7NO4/c1-5-2-6(8(10)11)4-7(3-5)9(12)13/h2-4H,1H3,(H,10,11) | |
| XAPRFOJQNGFJSZ-UHFFFAOYSA-N |
תגיות פופולריות: cas:113882-33-0|3-methyl-5-nitrobenzoic acid, price, quotation, discount, in stock, for sale
