CAS:3680-71-5|7-דיאזהיפוקסנטין
נוסחה מולקולרית: C6H5N3O
משקל מולקולרי: 135.12 גרם/מול
טוהר: 98 אחוז
חבילה: 5 גרם/10 גרם/25 גרם/50 גרם/חבילה בתפזורת
תחבורה: FeDex/DHL/משלוח אוקיינוס/דרישת לקוחות
- משלוחים לכל העולם
- בקרת איכות
- שירות לקוחות 24/7
הצגת המוצר
תיאור מוצרים
7-Deaza-6-hydroxypurine(CAS:3680-71-5) is a skeleton of nucleosides that inhibits enzymes. It has been shown to inhibit the activity of hydrochloric acid, a tumor metastasis promoter. The constant for this drug was determined using molecular modeling and inhibition constants. 7-Deaza-6-hydroxypurine(CAS:3680-71-5) has anticancer activity and can be used for the treatment of cancer. This drug is used as a noncompetitive inhibitor in which it binds to two different sites on the enzyme. It has also been shown to bind to subunits, which are parts of a protein that make up its structure, in biological studies.br>7-Deaza-6-hydroxypurine(CAS:3680-71-5) הוא מעכב הנקשר לשני אתרים שונים באנזים. הוכח שיש לו פעילות אנטי סרטנית וניתן להשתמש בו לטיפול בסרטן. תרופה זו משמשת כמעכב לא תחרותי בו היא נקשרת לשני אתרים שונים באנזים.
מִפרָט
|
פריטים |
מִפרָט |
|
שם IUPAC |
3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|
מס' MDL |
MFCD08445809 |
|
נקודת רתיחה |
473 מעלות ב-760 מ"מ כספית |
|
נקודת המסה |
תואר 345-348 |
|
נקודת רתיחה |
239.9±21.2 מעלות |
|
צְפִיפוּת |
1.6±0.1 גרם/ס"מ3 |
|
PSA |
61.54 |
|
LogP |
-0.70 |
|
מראה חיצוני |
אוף-וייט עד חום בהיר (מוצק) |
|
מְסִיסוּת |
מסיס ב-DMSO |
|
לחץ קיטור |
{{0}}.0±1.2 מ"מ כספית ב-25 מעלות |
|
מקדם השבירה |
1.784 |
|
מצב אחסון |
שמור במקום חשוך, אטום ביבש, טמפרטורת החדר |
|
InChI |
InChI=1S/C6H5N3O/c10-6-4-1-2-7-5(4)8-3-9-6/h1-3H,(H2,7,8,9,10) |
|
InChIKey |
FBMZEITWVNHWJW-UHFFFAOYSA-N |

תגיות פופולריות: cas:3680-71-5|7-deazahypoxanthine, מחיר, הצעת מחיר, הנחה, במלאי, למכירה







![CAS 1408282-26-7|8-fluoro-1,3,4,5-tetrahydro-azepino[5,4,3-cd]indol{10}}one](/uploads/202235855/small/cas-1408282-26-7-8-fluoro-1-3-4-5-tetrahydro57374852633.png?size=384x0)
